CAS
501435-91-2 Purity
98%
501435-91-2 Purity
98%
Inquiry Basket
3,4-Difluoro-2-ethoxyphenylboronic acid
CAS
1451391-69-7
Catalog Number
ACM1451391697
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 3,4-Difluoro-2-ethoxyphenylboronic acid?
The molecular formula of 3,4-Difluoro-2-ethoxyphenylboronic acid is C8H9BF2O3.
What is the molecular weight of 3,4-Difluoro-2-ethoxyphenylboronic acid?
The molecular weight of 3,4-Difluoro-2-ethoxyphenylboronic acid is 201.97 g/mol.
What is the IUPAC name of 3,4-Difluoro-2-ethoxyphenylboronic acid?
The IUPAC name of 3,4-Difluoro-2-ethoxyphenylboronic acid is (2-ethoxy-3,4-difluorophenyl)boronic acid.
What is the InChI of 3,4-Difluoro-2-ethoxyphenylboronic acid?
The InChI of 3,4-Difluoro-2-ethoxyphenylboronic acid is InChI=1S/C8H9BF2O3/c1-2-14-8-5(9(12)13)3-4-6(10)7(8)11/h3-4,12-13H,2H2,1H3.
What is the InChIKey of 3,4-Difluoro-2-ethoxyphenylboronic acid?
The InChIKey of 3,4-Difluoro-2-ethoxyphenylboronic acid is WIKOTGIBEIIHHU-UHFFFAOYSA-N.
What is the canonical SMILES of 3,4-Difluoro-2-ethoxyphenylboronic acid?
The canonical SMILES of 3,4-Difluoro-2-ethoxyphenylboronic acid is B(C1=C(C(=C(C=C1)F)F)OCC)(O)O.
What is the CAS number of 3,4-Difluoro-2-ethoxyphenylboronic acid?
The CAS number of 3,4-Difluoro-2-ethoxyphenylboronic acid is 1451391-69-7.
What is the hydrogen bond donor count of 3,4-Difluoro-2-ethoxyphenylboronic acid?
The hydrogen bond donor count of 3,4-Difluoro-2-ethoxyphenylboronic acid is 2.
What is the hydrogen bond acceptor count of 3,4-Difluoro-2-ethoxyphenylboronic acid?
The hydrogen bond acceptor count of 3,4-Difluoro-2-ethoxyphenylboronic acid is 5.
What is the topological polar surface area of 3,4-Difluoro-2-ethoxyphenylboronic acid?
The topological polar surface area of 3,4-Difluoro-2-ethoxyphenylboronic acid is 49.7Ų.
Recommended Products
