CAS
1451391-69-7 Purity
---
1451391-69-7 Purity
---
Inquiry Basket
5-Carboxy-2-ethoxyphenylboronic acid
CAS
1451391-73-3
Catalog Number
ACM1451391733
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 5-Carboxy-2-ethoxyphenylboronic acid?
The molecular formula of 5-Carboxy-2-ethoxyphenylboronic acid is C9H11BO5.
What is the molecular weight of 5-Carboxy-2-ethoxyphenylboronic acid?
The molecular weight of 5-Carboxy-2-ethoxyphenylboronic acid is 209.99 g/mol.
What is the IUPAC name of 5-Carboxy-2-ethoxyphenylboronic acid?
The IUPAC name of 5-Carboxy-2-ethoxyphenylboronic acid is 3-borono-4-ethoxybenzoic acid.
What is the InChI of 5-Carboxy-2-ethoxyphenylboronic acid?
The InChI of 5-Carboxy-2-ethoxyphenylboronic acid is InChI=1S/C9H11BO5/c1-2-15-8-4-3-6(9(11)12)5-7(8)10(13)14/h3-5,13-14H,2H2,1H3,(H,11,12).
What is the InChIKey of 5-Carboxy-2-ethoxyphenylboronic acid?
The InChIKey of 5-Carboxy-2-ethoxyphenylboronic acid is CMUVOHRXIPPHFW-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Carboxy-2-ethoxyphenylboronic acid?
The canonical SMILES of 5-Carboxy-2-ethoxyphenylboronic acid is B(C1=C(C=CC(=C1)C(=O)O)OCC)(O)O.
How many hydrogen bond donor count does 5-Carboxy-2-ethoxyphenylboronic acid have?
5-Carboxy-2-ethoxyphenylboronic acid has 3 hydrogen bond donor count.
How many hydrogen bond acceptor count does 5-Carboxy-2-ethoxyphenylboronic acid have?
5-Carboxy-2-ethoxyphenylboronic acid has 5 hydrogen bond acceptor count.
How many rotatable bond count does 5-Carboxy-2-ethoxyphenylboronic acid have?
5-Carboxy-2-ethoxyphenylboronic acid has 4 rotatable bond count.
What is the topological polar surface area of 5-Carboxy-2-ethoxyphenylboronic acid?
The topological polar surface area of 5-Carboxy-2-ethoxyphenylboronic acid is 87Ų.
Recommended Products
