([4-(Trifluoromethyl)benzoyl]amino)acetic acid

• Catalog Number: ACMA00000809
• Category: Amines
• Molecular Weight: 247.17
• Molecular Formula: C₁₀H₁₆N₂
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound with PubChem CID 2305084?

The molecular formula is C10H8F3NO3.

What is the molecular weight of the compound?

The molecular weight is 247.17 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is 2-[[4-(trifluoromethyl)benzoyl]amino]acetic acid.

What is the Canonical SMILES of the compound?

The Canonical SMILES is C1=CC(=CC=C1C(=O)NCC(=O)O)C(F)(F)F.

What is the InChIKey of the compound?

The InChIKey is BSDJCHNAUGZKFS-UHFFFAOYSA-N.

What is the CAS number of the compound?

The CAS number is 89035-91-6.

How many hydrogen bond donor counts does the compound have?

The compound has 2 hydrogen bond donor counts.

What is the XLogP3 value of the compound?

The XLogP3 value is 2.2.

What is the topological polar surface area of the compound?

The topological polar surface area is 66.4Ų.

Is the compound canonicalized?

Yes, the compound is canonicalized.