5-Bromo-naphthalen-1-ylamine

• Catalog Number: ACMA00000811
• Category: Amines
• Molecular Weight: 222.08
• Molecular Formula: C₁₀H₁₆N₂
• Hazard Statements: H317
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 5-Bromo-naphthalen-1-ylamine?

The molecular formula of 5-Bromo-naphthalen-1-ylamine is C10H8BrN.

What is the molecular weight of 5-Bromo-naphthalen-1-ylamine?

The molecular weight of 5-Bromo-naphthalen-1-ylamine is 222.08 g/mol.

What is the IUPAC name of 5-Bromo-naphthalen-1-ylamine?

The IUPAC name of 5-Bromo-naphthalen-1-ylamine is 5-bromonaphthalen-1-amine.

What is the InChI of 5-Bromo-naphthalen-1-ylamine?

The InChI of 5-Bromo-naphthalen-1-ylamine is InChI=1S/C10H8BrN/c11-9-5-1-4-8-7(9)3-2-6-10(8)12/h1-6H,12H2.

What is the InChIKey of 5-Bromo-naphthalen-1-ylamine?

The InChIKey of 5-Bromo-naphthalen-1-ylamine is VNPCNUAYDOLBDR-UHFFFAOYSA-N.

What is the canonical SMILES representation of 5-Bromo-naphthalen-1-ylamine?

The canonical SMILES representation of 5-Bromo-naphthalen-1-ylamine is C1=CC2=C(C=CC=C2Br)C(=C1)N.

What is the CAS number of 5-Bromo-naphthalen-1-ylamine?

The CAS number of 5-Bromo-naphthalen-1-ylamine is 4766-33-0.

What is the XLogP3 value of 5-Bromo-naphthalen-1-ylamine?

The XLogP3 value of 5-Bromo-naphthalen-1-ylamine is 2.9.

What is the hydrogen bond donor count of 5-Bromo-naphthalen-1-ylamine?

The hydrogen bond donor count of 5-Bromo-naphthalen-1-ylamine is 1.

What is the rotatable bond count of 5-Bromo-naphthalen-1-ylamine?

The rotatable bond count of 5-Bromo-naphthalen-1-ylamine is 0.