4-(Phenoxymethyl)benzenecarboxylic acid

• Catalog Number: ACMA00002448
• Category: Ethers
• Molecular Weight: 228.24
• Molecular Formula: C₁₄H₁₂O₂
• Hazard Statements: H302-H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 4-(Phenoxymethyl)benzenecarboxylic acid?

The molecular formula of 4-(Phenoxymethyl)benzenecarboxylic acid is C14H12O3.

What is the molecular weight of 4-(Phenoxymethyl)benzenecarboxylic acid?

The molecular weight of 4-(Phenoxymethyl)benzenecarboxylic acid is 228.24 g/mol.

What is the IUPAC name of 4-(Phenoxymethyl)benzenecarboxylic acid?

The IUPAC name of 4-(Phenoxymethyl)benzenecarboxylic acid is 4-(phenoxymethyl)benzoic acid.

What is the InChI of 4-(Phenoxymethyl)benzenecarboxylic acid?

The InChI of 4-(Phenoxymethyl)benzenecarboxylic acid is InChI=1S/C14H12O3/c15-14(16)12-8-6-11(7-9-12)10-17-13-4-2-1-3-5-13/h1-9H,10H2,(H,15,16).

What is the InChIKey of 4-(Phenoxymethyl)benzenecarboxylic acid?

The InChIKey of 4-(Phenoxymethyl)benzenecarboxylic acid is GRBUVHSYBRTCIB-UHFFFAOYSA-N.

What is the canonical SMILES of 4-(Phenoxymethyl)benzenecarboxylic acid?

The canonical SMILES of 4-(Phenoxymethyl)benzenecarboxylic acid is C1=CC=C(C=C1)OCC2=CC=C(C=C2)C(=O)O.

What is the CAS number of 4-(Phenoxymethyl)benzenecarboxylic acid?

The CAS number of 4-(Phenoxymethyl)benzenecarboxylic acid is 31719-76-3.

What is the XLogP3 value of 4-(Phenoxymethyl)benzenecarboxylic acid?

The XLogP3 value of 4-(Phenoxymethyl)benzenecarboxylic acid is 3.3.

How many hydrogen bond donor count does 4-(Phenoxymethyl)benzenecarboxylic acid have?

4-(Phenoxymethyl)benzenecarboxylic acid has 1 hydrogen bond donor count.

How many rotatable bond count does 4-(Phenoxymethyl)benzenecarboxylic acid have?

4-(Phenoxymethyl)benzenecarboxylic acid has 4 rotatable bond count.