4-(Phenoxymethyl)benzaldehyde

• Catalog Number: ACMA00002450
• Category: Ethers
• Molecular Weight: 212.24
• Molecular Formula: C₁₄H₁₂ClFO₂
• Hazard Statements: H318
• RIDADR: UN 3077 9 / PGIII
• Symbol: GHS05

Custom Q&A

What is the molecular formula of 4-(Phenoxymethyl)benzaldehyde?

The molecular formula is C14H12O2.

What is the molecular weight of 4-(Phenoxymethyl)benzaldehyde?

The molecular weight is 212.24 g/mol.

What is the IUPAC name of 4-(Phenoxymethyl)benzaldehyde?

The IUPAC name is 4-(phenoxymethyl)benzaldehyde.

What is the InChI of 4-(Phenoxymethyl)benzaldehyde?

The InChI is InChI=1S/C14H12O2/c15-10-12-6-8-13(9-7-12)11-16-14-4-2-1-3-5-14/h1-10H,11H2.

What is the InChIKey of 4-(Phenoxymethyl)benzaldehyde?

The InChIKey is JLGXYDMVIJFOKF-UHFFFAOYSA-N.

What is the canonical SMILES of 4-(Phenoxymethyl)benzaldehyde?

The canonical SMILES is C1=CC=C(C=C1)OCC2=CC=C(C=C2)C=O.

What is the CAS number of 4-(Phenoxymethyl)benzaldehyde?

The CAS number is 2683-70-7.

What is the XLogP3 value of 4-(Phenoxymethyl)benzaldehyde?

The XLogP3 value is 3.3.

What is the hydrogen bond acceptor count of 4-(Phenoxymethyl)benzaldehyde?

The hydrogen bond acceptor count is 2.