2-(2-Methylphenoxy)benzoic acid

• Catalog Number: ACMA00002449
• Category: Ethers
• Molecular Weight: 228.24
• Molecular Formula: C₁₄H₁₂O₂
• Hazard Statements: H318
• RIDADR: NONH for all modes of transport
• Symbol: GHS05

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C14H12O3.

What is the molecular weight of the compound?

The molecular weight of the compound is 228.24 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 2-(2-methylphenoxy)benzoic acid.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C14H12O3/c1-10-6-2-4-8-12(10)17-13-9-5-3-7-11(13)14(15)16/h2-9H,1H3,(H,15,16).

What is the InChIKey of the compound?

The InChIKey of the compound is JMFDKESIMZREMY-UHFFFAOYSA-N.

What are the synonyms of the compound?

The synonyms of the compound are 2-(2-methylphenoxy)benzoic acid, 6325-68-4, 2-(o-Tolyloxy)benzoic acid, Benzoic acid, o-(o-tolyloxy)-, NSC31105.

What is the CAS number of the compound?

The CAS number of the compound is 6325-68-4.

What is the XLogP3 value of the compound?

The XLogP3 value of the compound is 3.5.

What is the hydrogen bond donor count of the compound?

The hydrogen bond donor count of the compound is 1.

Is the compound canonicalized?

Yes, the compound is canonicalized.