(5-Chlorosulfonyl-naphthalen-1-yl)-carbamic acid2-methoxy-ethyl ester

• Catalog Number: ACMA00002445
• Category: Ethers
• Molecular Weight: 343.78
• Molecular Formula: C₁₄H₁₂O₃
• Hazard Statements: H317
• RIDADR: UN 3261 8 / PGII
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C14H14ClNO5S.

What are the synonyms of the compound?

The synonyms of the compound are 728864-82-2, 2-Methoxyethyl (5-(chlorosulfonyl)naphthalen-1-yl)carbamate, 2-methoxyethyl N-(5-chlorosulfonylnaphthalen-1-yl)carbamate, (5-chlorosulfonyl-naphthalen-1-yl)-carbamic acid2-methoxy-ethyl ester, SB83458.

What is the molecular weight of the compound?

The molecular weight of the compound is 343.8 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 2-methoxyethyl N-(5-chlorosulfonylnaphthalen-1-yl)carbamate.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C14H14ClNO5S/c1-20-8-9-21-14(17)16-12-6-2-5-11-10(12)4-3-7-13(11)22(15,18)19/h2-7H,8-9H2,1H3,(H,16,17).

What is the InChIKey of the compound?

The InChIKey of the compound is MCKVNSRTQQIWAN-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is COCCOC(=O)NC1=CC=CC2=C1C=CC=C2S(=O)(=O)Cl.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 2.6.

How many hydrogen bond donor counts does the compound have?

The compound has 1 hydrogen bond donor count.

How many rotatable bond counts does the compound have?

The compound has 6 rotatable bond counts.