4-Iodopyridin-2-amine

• CAS: 552331-00-7
• Catalog Number: ACM552331007
• Category: Pyridines
• Molecular Weight: 220.0
• Molecular Formula: C5H5IN2

Custom Q&A

What is the molecular formula of 4-Iodopyridin-2-amine?

The molecular formula of 4-Iodopyridin-2-amine is C5H5IN2.

What is the molecular weight of 4-Iodopyridin-2-amine?

The molecular weight of 4-Iodopyridin-2-amine is 220.01 g/mol.

What is the IUPAC name of 4-Iodopyridin-2-amine?

The IUPAC name of 4-Iodopyridin-2-amine is 4-iodopyridin-2-amine.

What is the InChI of 4-Iodopyridin-2-amine?

The InChI of 4-Iodopyridin-2-amine is InChI=1S/C5H5IN2/c6-4-1-2-8-5(7)3-4/h1-3H,(H2,7,8).

How many hydrogen bond donor counts are there in 4-Iodopyridin-2-amine?

There is 1 hydrogen bond donor count in 4-Iodopyridin-2-amine.

What is the topological polar surface area of 4-Iodopyridin-2-amine?

The topological polar surface area of 4-Iodopyridin-2-amine is 38.9 Ų.

Is 4-Iodopyridin-2-amine a canonicalized compound?

Yes, 4-Iodopyridin-2-amine is a canonicalized compound.

What is the XLogP3 value of 4-Iodopyridin-2-amine?

The XLogP3 value of 4-Iodopyridin-2-amine is 0.8.

How many defined atom stereocenters are there in 4-Iodopyridin-2-amine?

There are 0 defined atom stereocenters in 4-Iodopyridin-2-amine.

What is the CAS number of 4-Iodopyridin-2-amine?

The CAS number of 4-Iodopyridin-2-amine is 552331-00-7.