3-Bromo-4-chloro-5-fluoropyridine

• CAS: 1211540-92-9
• Catalog Number: ACM1211540929
• Category: Pyridines
• Molecular Weight: 210.4
• Molecular Formula: C5H2BrClFN

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C5H2BrClFN.

What are the synonyms of the compound?

The synonyms of the compound are 3-Bromo-4-chloro-5-fluoropyridine, 1211540-92-9, MFCD18257571, SCHEMBL13725666, and DGAXTZFGBOIDAB-UHFFFAOYSA-N.

What is the molecular weight of the compound?

The molecular weight of the compound is 210.43 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 3-bromo-4-chloro-5-fluoropyridine.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C5H2BrClFN/c6-3-1-9-2-4(8)5(3)7/h1-2H.

What is the InChIKey of the compound?

The InChIKey of the compound is DGAXTZFGBOIDAB-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is C1=C(C(=C(C=N1)Br)Cl)F.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 2.3.

How many hydrogen bond donor atoms are present in the compound?

There are 0 hydrogen bond donor atoms present in the compound.

How many hydrogen bond acceptor atoms are present in the compound?

There are 2 hydrogen bond acceptor atoms present in the compound.