2,5-Dibromo-4-iodopyridine

• CAS: 1061357-86-5
• Catalog Number: ACM1061357865
• Category: Pyridines
• Molecular Weight: 362.78
• Molecular Formula: C5H2Br2IN
• Melting Point: 141-143 °C

Custom Q&A

What is the molecular formula of 2,5-Dibromo-4-iodopyridine?

The molecular formula of 2,5-Dibromo-4-iodopyridine is C5H2Br2IN.

What is the molecular weight of 2,5-Dibromo-4-iodopyridine?

The molecular weight of 2,5-Dibromo-4-iodopyridine is 362.79 g/mol.

How is the IUPAC name of 2,5-Dibromo-4-iodopyridine computed?

The IUPAC name of 2,5-Dibromo-4-iodopyridine is computed by LexiChem 2.6.6.

What is the InChI of 2,5-Dibromo-4-iodopyridine?

The InChI of 2,5-Dibromo-4-iodopyridine is InChI=1S/C5H2Br2IN/c6-3-2-9-5(7)1-4(3)8/h1-2H.

What is the InChIKey of 2,5-Dibromo-4-iodopyridine?

The InChIKey of 2,5-Dibromo-4-iodopyridine is JHAWIJLEDSUTBA-UHFFFAOYSA-N.

What is the Canonical SMILES of 2,5-Dibromo-4-iodopyridine?

The Canonical SMILES of 2,5-Dibromo-4-iodopyridine is C1=C(C(=CN=C1Br)Br)I.

What is the XLogP3-AA value of 2,5-Dibromo-4-iodopyridine?

The XLogP3-AA value of 2,5-Dibromo-4-iodopyridine is 3.2.

How many hydrogen bond donor counts does 2,5-Dibromo-4-iodopyridine have?

2,5-Dibromo-4-iodopyridine has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 2,5-Dibromo-4-iodopyridine have?

2,5-Dibromo-4-iodopyridine has 1 hydrogen bond acceptor count.

How many rotatable bond counts does 2,5-Dibromo-4-iodopyridine have?

2,5-Dibromo-4-iodopyridine has 0 rotatable bond counts.