4-(Ethylcarbamoyl)-2-methoxyphenylboronic acid

• CAS: 1443112-49-9
• Catalog Number: ACM1443112499
• Category: Boronic Acids

Custom Q&A

What is the molecular formula of 4-(Ethylcarbamoyl)-2-methoxyphenylboronic acid?

The molecular formula is C10H14BNO4.

When was the compound first created and last modified?

The compound was first created on 2012-08-08 and last modified on 2023-12-02.

What is the IUPAC name of the compound?

The IUPAC name is [4-(ethylcarbamoyl)-2-methoxyphenyl]boronic acid.

What is the InChI of the compound?

The InChI is InChI=1S/C10H14BNO4/c1-3-12-10(13)7-4-5-8(11(14)15)9(6-7)16-2/h4-6,14-15H,3H2,1-2H3,(H,12,13).

What is the InChIKey of the compound?

The InChIKey is LHAPIHFWFYPOQN-UHFFFAOYSA-N.

How many hydrogen bond donor counts does the compound have?

The compound has 3 hydrogen bond donor counts.

What is the heavy atom count of the compound?

The heavy atom count is 16.

What is the exact mass of the compound?

The exact mass is 223.1015881 g/mol.

Is the compound canonicalized?

Yes, the compound is canonicalized.

How many rotatable bond counts does the compound have?

The compound has 4 rotatable bond counts.