CAS
1333388-00-3 Purity
---
1333388-00-3 Purity
---
Inquiry Basket
4-Bromo-2-(trifluoromethyl)phenylboronic acid
CAS
1394346-22-5
Catalog Number
ACM1394346225
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 4-Bromo-2-(trifluoromethyl)phenylboronic acid?
The molecular formula of 4-Bromo-2-(trifluoromethyl)phenylboronic acid is C7H5BBrF3O2.
What are the synonyms for 4-Bromo-2-(trifluoromethyl)phenylboronic acid?
The synonyms for 4-Bromo-2-(trifluoromethyl)phenylboronic acid include 1394346-22-5, 4-Bromo-2-(trifluoromethyl)benzeneboronic acid, and (4-Bromo-2-(trifluoromethyl)phenyl)boronic acid.
What is the molecular weight of 4-Bromo-2-(trifluoromethyl)phenylboronic acid?
The molecular weight of 4-Bromo-2-(trifluoromethyl)phenylboronic acid is 268.83 g/mol.
What is the IUPAC name of 4-Bromo-2-(trifluoromethyl)phenylboronic acid?
The IUPAC name of 4-Bromo-2-(trifluoromethyl)phenylboronic acid is [4-bromo-2-(trifluoromethyl)phenyl]boronic acid.
What is the InChI of 4-Bromo-2-(trifluoromethyl)phenylboronic acid?
The InChI of 4-Bromo-2-(trifluoromethyl)phenylboronic acid is InChI=1S/C7H5BBrF3O2/c9-4-1-2-6(8(13)14)5(3-4)7(10,11)12/h1-3,13-14H.
What is the InChIKey of 4-Bromo-2-(trifluoromethyl)phenylboronic acid?
The InChIKey of 4-Bromo-2-(trifluoromethyl)phenylboronic acid is CSIDLWXFPCSSOK-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromo-2-(trifluoromethyl)phenylboronic acid?
The canonical SMILES of 4-Bromo-2-(trifluoromethyl)phenylboronic acid is B(C1=C(C=C(C=C1)Br)C(F)(F)F)(O)O.
What is the hydrogen bond donor count for 4-Bromo-2-(trifluoromethyl)phenylboronic acid?
The hydrogen bond donor count for 4-Bromo-2-(trifluoromethyl)phenylboronic acid is 2.
What is the hydrogen bond acceptor count for 4-Bromo-2-(trifluoromethyl)phenylboronic acid?
The hydrogen bond acceptor count for 4-Bromo-2-(trifluoromethyl)phenylboronic acid is 5.
What is the rotatable bond count for 4-Bromo-2-(trifluoromethyl)phenylboronic acid?
The rotatable bond count for 4-Bromo-2-(trifluoromethyl)phenylboronic acid is 1.
Recommended Products
