4-(Ethoxycarbonyl)methoxyphenylboronic acid pinacol ester

• CAS: 269410-28-8
• Catalog Number: ACM269410288
• Category: Boronic Acids
• Molecular Weight: 306.16
• Molecular Formula: C₁₆H₂₃BO₅

Custom Q&A

What is the molecular formula of the compound described in the reference?

The molecular formula of the compound is C16H23BO5.

What is the IUPAC name of the compound?

The IUPAC name of the compound is ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetate.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C16H23BO5/c1-6-19-14(18)11-20-13-9-7-12(8-10-13)17-21-15(2,3)16(4,5)22-17/h7-10H,6,11H2,1-5H3.

What is the InChIKey of the compound?

The InChIKey of the compound is IWVRBFCAALMWBP-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCC(=O)OCC.

What is the CAS number of the compound?

The CAS number of the compound is 269410-28-8.

What is the molecular weight of the compound?

The molecular weight of the compound is 306.2 g/mol.

How many hydrogen bond donor counts does the compound have?

The compound has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does the compound have?

The compound has 5 hydrogen bond acceptor counts.

How many rotatable bond counts does the compound have?

The compound has 6 rotatable bond counts.