Pyridine-3-boronic acid HCL

• CAS: 265664-63-9
• Catalog Number: ACM265664639
• Category: Boronic Acids
• Molecular Weight: 159.38
• Molecular Formula: C₅H₇BClNO₂
• Synonyms: PYRIDINE-3-BORONIC ACID HCL;PYRIDINE-3-BORONIC ACID HYDROCHLORIDE

Custom Q&A

What is the molecular formula of Pyridine-3-boronic acid HCL?

The molecular formula of Pyridine-3-boronic acid HCL is C5H7BClNO2.

What are the synonyms for Pyridine-3-boronic acid HCL?

The synonyms for Pyridine-3-boronic acid HCL are PYRIDINE-3-BORONIC ACID HYDROCHLORIDE, PYRIDINE-3-BORONIC ACID HCL, pyridin-3-ylboronic acid hydrochloride, and pyridin-3-ylboronic acid;hydrochloride.

What is the molecular weight of Pyridine-3-boronic acid HCL?

The molecular weight of Pyridine-3-boronic acid HCL is 159.38 g/mol.

What is the IUPAC name of Pyridine-3-boronic acid HCL?

The IUPAC name of Pyridine-3-boronic acid HCL is pyridin-3-ylboronic acid;hydrochloride.

What is the InChI of Pyridine-3-boronic acid HCL?

The InChI of Pyridine-3-boronic acid HCL is InChI=1S/C5H6BNO2.ClH/c8-6(9)5-2-1-3-7-4-5;/h1-4,8-9H;1H.

What is the InChIKey of Pyridine-3-boronic acid HCL?

The InChIKey of Pyridine-3-boronic acid HCL is QIXCETIHXIFXGF-UHFFFAOYSA-N.

What is the canonical SMILES of Pyridine-3-boronic acid HCL?

The canonical SMILES of Pyridine-3-boronic acid HCL is B(C1=CN=CC=C1)(O)O.Cl.

What is the CAS number of Pyridine-3-boronic acid HCL?

The CAS number of Pyridine-3-boronic acid HCL is 265664-63-9.

How many hydrogen bond donor counts does Pyridine-3-boronic acid HCL have?

Pyridine-3-boronic acid HCL has 3 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does Pyridine-3-boronic acid HCL have?

Pyridine-3-boronic acid HCL has 3 hydrogen bond acceptor counts.