4-Benzylaminocyclohexanone

• Catalog Number: ACMA00001068
• Category: Amines
• Molecular Weight: 203.28
• Molecular Formula: C₁₃H₁₅ClN₂
• Hazard Statements: H302-H317-H319-H410
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 4-Benzylaminocyclohexanone?

The molecular formula is C13H17NO.

What is the molecular weight of 4-Benzylaminocyclohexanone?

The molecular weight is 203.28 g/mol.

What is the IUPAC name of 4-Benzylaminocyclohexanone?

The IUPAC name is 4-(benzylamino)cyclohexan-1-one.

What is the InChI of 4-Benzylaminocyclohexanone?

The InChI is InChI=1S/C13H17NO/c15-13-8-6-12(7-9-13)14-10-11-4-2-1-3-5-11/h1-5,12,14H,6-10H2.

What is the InChIKey of 4-Benzylaminocyclohexanone?

The InChIKey is NMCDGVLRNAILQW-UHFFFAOYSA-N.

What is the Canonical SMILES of 4-Benzylaminocyclohexanone?

The Canonical SMILES is C1CC(=O)CCC1NCC2=CC=CC=C2.

What is the CAS number of 4-Benzylaminocyclohexanone?

The CAS number is 142009-99-2.

What is the XLogP3-AA value of 4-Benzylaminocyclohexanone?

The XLogP3-AA value is 1.5.

How many hydrogen bond donor counts does 4-Benzylaminocyclohexanone have?

4-Benzylaminocyclohexanone has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 4-Benzylaminocyclohexanone have?

4-Benzylaminocyclohexanone has 2 hydrogen bond acceptor counts.