1-(2,2-Dimethyl-1-phenylcyclopropyl)-N-methylmethanamine

• Catalog Number: ACMA00001065
• Category: Amines
• Molecular Weight: 189.30
• Molecular Formula: C₁₃H₁₇NO₃S
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula is C13H19N.

What is the molecular weight of the compound?

The molecular weight is 189.30 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is 1-(2,2-dimethyl-1-phenylcyclopropyl)-N-methylmethanamine.

What is the InChI code of the compound?

The InChI code is InChI=1S/C13H19N/c1-12(2)9-13(12,10-14-3)11-7-5-4-6-8-11/h4-8,14H,9-10H2,1-3H3.

What is the InChIKey of the compound?

The InChIKey is ZLYQUZYIAHGRFO-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES is CC1(CC1(CNC)C2=CC=CC=C2)C.

How many hydrogen bond donor count does the compound have?

The compound has 1 hydrogen bond donor count.

How many hydrogen bond acceptor count does the compound have?

The compound has 1 hydrogen bond acceptor count.

How many rotatable bond count does the compound have?

The compound has 3 rotatable bond count.

What is the topological polar surface area of the compound?

The topological polar surface area is 12Ų.