1-Amino-4-phenylcyclohexanecarboxylic acid

• Catalog Number: ACMA00001067
• Category: Amines
• Molecular Weight: 219.28
• Molecular Formula: C₁₃H₁₄N₂O₃S
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 1-Amino-4-phenylcyclohexanecarboxylic acid?

The molecular formula of 1-Amino-4-phenylcyclohexanecarboxylic acid is C13H17NO2.

What is the PubChem CID of 1-Amino-4-phenylcyclohexanecarboxylic acid?

The PubChem CID of 1-Amino-4-phenylcyclohexanecarboxylic acid is 22145292.

What is the IUPAC name of 1-Amino-4-phenylcyclohexanecarboxylic acid?

The IUPAC name of 1-Amino-4-phenylcyclohexanecarboxylic acid is 1-amino-4-phenylcyclohexane-1-carboxylic acid.

What is the InChI of 1-Amino-4-phenylcyclohexanecarboxylic acid?

The InChI of 1-Amino-4-phenylcyclohexanecarboxylic acid is InChI=1S/C13H17NO2/c14-13(12(15)16)8-6-11(7-9-13)10-4-2-1-3-5-10/h1-5,11H,6-9,14H2,(H,15,16).

What is the InChIKey of 1-Amino-4-phenylcyclohexanecarboxylic acid?

The InChIKey of 1-Amino-4-phenylcyclohexanecarboxylic acid is TWAYLYPZRSXEOS-UHFFFAOYSA-N.

What is the canonical SMILES of 1-Amino-4-phenylcyclohexanecarboxylic acid?

The canonical SMILES of 1-Amino-4-phenylcyclohexanecarboxylic acid is C1CC(CCC1C2=CC=CC=C2)(C(=O)O)N.

What is the molecular weight of 1-Amino-4-phenylcyclohexanecarboxylic acid?

The molecular weight of 1-Amino-4-phenylcyclohexanecarboxylic acid is 219.28 g/mol.

What is the XLogP3-AA value of 1-Amino-4-phenylcyclohexanecarboxylic acid?

The XLogP3-AA value of 1-Amino-4-phenylcyclohexanecarboxylic acid is -0.6.

How many hydrogen bond donor counts does 1-Amino-4-phenylcyclohexanecarboxylic acid have?

1-Amino-4-phenylcyclohexanecarboxylic acid has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 1-Amino-4-phenylcyclohexanecarboxylic acid have?

1-Amino-4-phenylcyclohexanecarboxylic acid has 3 hydrogen bond acceptor counts.