4-[(2-Chlorobenzyl)oxy]-3-ethoxybenzaldehyde

• Catalog Number: ACMA00002972
• Category: Ethers
• Molecular Weight: 290.74
• Molecular Formula: C₁₆H₁₄O₄
• Hazard Statements: H317
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound with PubChem CID 693303?

The molecular formula is C16H15ClO3.

What is the molecular weight of the compound?

The molecular weight is 290.74 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is 4-[(2-chlorophenyl)methoxy]-3-ethoxybenzaldehyde.

What is the InChI of the compound?

The InChI is InChI=1S/C16H15ClO3/c1-2-19-16-9-12(10-18)7-8-15(16)20-11-13-5-3-4-6-14(13)17/h3-10H,2,11H2,1H3.

What is the InChIKey of the compound?

The InChIKey is FZLDPXJDXURLIX-UHFFFAOYSA-N.

What is the Canonical SMILES of the compound?

The Canonical SMILES is CCOC1=C(C=CC(=C1)C=O)OCC2=CC=CC=C2Cl.

How many hydrogen bond donor counts does the compound have?

The compound has 0 hydrogen bond donor counts.

What is the topological polar surface area of the compound?

The topological polar surface area is 35.5 Ų.

How many rotatable bond counts does the compound have?

The compound has 6 rotatable bond counts.

Is the compound canonicalized?

Yes, the compound is canonicalized according to PubChem (release 2011.04.04).