4-[(4-Chlorobenzyl)oxy]-3-ethoxybenzaldehyde

• Catalog Number: ACMA00002973
• Category: Ethers
• Molecular Weight: 290.74
• Molecular Formula: C₁₆H₁₄O₃
• Hazard Statements: H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 4-[(4-Chlorobenzyl)oxy]-3-ethoxybenzaldehyde?

The molecular formula is C16H15ClO3.

What is the molecular weight of 4-[(4-Chlorobenzyl)oxy]-3-ethoxybenzaldehyde?

The molecular weight is 290.74 g/mol.

What is the IUPAC name of 4-[(4-Chlorobenzyl)oxy]-3-ethoxybenzaldehyde?

The IUPAC name is 4-[(4-chlorophenyl)methoxy]-3-ethoxybenzaldehyde.

What is the InChI of 4-[(4-Chlorobenzyl)oxy]-3-ethoxybenzaldehyde?

The InChI is InChI=1S/C16H15ClO3/c1-2-19-16-9-13(10-18)5-8-15(16)20-11-12-3-6-14(17)7-4-12/h3-10H,2,11H2,1H3.

What is the InChIKey of 4-[(4-Chlorobenzyl)oxy]-3-ethoxybenzaldehyde?

The InChIKey is RKDKWRMABXGUPQ-UHFFFAOYSA-N.

What is the canonical SMILES of 4-[(4-Chlorobenzyl)oxy]-3-ethoxybenzaldehyde?

The canonical SMILES is CCOC1=C(C=CC(=C1)C=O)OCC2=CC=C(C=C2)Cl.

What is the CAS number of 4-[(4-Chlorobenzyl)oxy]-3-ethoxybenzaldehyde?

The CAS number is 299441-96-6.

What is the ChEMBL ID of 4-[(4-Chlorobenzyl)oxy]-3-ethoxybenzaldehyde?

The ChEMBL ID is CHEMBL4111499.

What is the DSSTox Substance ID of 4-[(4-Chlorobenzyl)oxy]-3-ethoxybenzaldehyde?

The DSSTox Substance ID is DTXSID50351216.

Is 4-[(4-Chlorobenzyl)oxy]-3-ethoxybenzaldehyde a canonicalized compound?

Yes, 4-[(4-Chlorobenzyl)oxy]-3-ethoxybenzaldehyde is canonicalized.