CAS
--- Purity
---
--- Purity
---
Inquiry Basket
3-Ethoxy-4-[(2-fluorobenzyl)oxy]benzaldehyde
Catalog Number
ACMA00002970
Category
Ethers
Molecular Weight
274.29
Molecular Formula
C16H14O4
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H317
RIDADR
NONH for all modes of transport
Symbol
GHS07
What is the molecular formula of the compound with PubChem CID 735470?
The molecular formula is C16H15FO3.
What is another name for the compound with PubChem CID 735470?
3-ethoxy-4-[(2-fluorobenzyl)oxy]benzaldehyde.
When was the compound with PubChem CID 735470 created and last modified?
It was created on 2005-07-08 and last modified on 2023-11-25.
What is the molecular weight of the compound with PubChem CID 735470?
The molecular weight is 274.29 g/mol.
What is the InChIKey of the compound with PubChem CID 735470?
The InChIKey is FTJDNMALMIFLKJ-UHFFFAOYSA-N.
How many hydrogen bond acceptor counts does the compound with PubChem CID 735470 have?
It has 4 hydrogen bond acceptor counts.
What is the exact mass of the compound with PubChem CID 735470?
The exact mass is 274.10052250 g/mol.
How many rotatable bond counts does the compound with PubChem CID 735470 have?
It has 6 rotatable bond counts.
What is the topological polar surface area of the compound with PubChem CID 735470?
The topological polar surface area is 35.5Ų.
Is the compound with PubChem CID 735470 canonicalized?
Yes, the compound is canonicalized.
What are the synonyms of the compound?
The synonyms are 423724-00-9, 3-ethoxy-4-[(2-fluorobenzyl)oxy]benzaldehyde, 3-Ethoxy-4-(2-fluoro-benzyloxy)-benzaldehyde, and more.
When was the compound first created and last modified?
It was first created on 2005-07-08 and last modified on 2023-11-25.
What is the IUPAC name of the compound?
The IUPAC name is 3-ethoxy-4-[(2-fluorophenyl)methoxy]benzaldehyde.
What is the Canonical SMILES of the compound?
The Canonical SMILES is CCOC1=C(C=CC(=C1)C=O)OCC2=CC=CC=C2F.
What is the molecular weight of the compound?
The molecular weight is 274.29 g/mol.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value is 3.3.
How many hydrogen bond acceptors does the compound have?
The compound has 4 hydrogen bond acceptors.
What is the topological polar surface area of the compound?
The topological polar surface area is 35.5Ų.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
