1,2,3,4-Tetrahydro-1-naphthalenemethanamine

• Catalog Number: ACMA00000948
• Category: Amines
• Molecular Weight: 161.24
• Molecular Formula: C₁₁H₁₄INO₂
• Hazard Statements: H319
• RIDADR: UN 3082 9 / PGIII
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 1,2,3,4-Tetrahydro-1-naphthalenemethanamine?

The molecular formula is C11H15N.

What is the molecular weight of 1,2,3,4-Tetrahydro-1-naphthalenemethanamine?

The molecular weight is 161.24 g/mol.

What is the IUPAC name of 1,2,3,4-Tetrahydro-1-naphthalenemethanamine?

The IUPAC name is 1,2,3,4-tetrahydronaphthalen-1-ylmethanamine.

What is the InChI of 1,2,3,4-Tetrahydro-1-naphthalenemethanamine?

The InChI is InChI=1S/C11H15N/c12-8-10-6-3-5-9-4-1-2-7-11(9)10/h1-2,4,7,10H,3,5-6,8,12H2.

What is the InChIKey of 1,2,3,4-Tetrahydro-1-naphthalenemethanamine?

The InChIKey is FSEUPTSLGGJFNX-UHFFFAOYSA-N.

What is the canonical SMILES of 1,2,3,4-Tetrahydro-1-naphthalenemethanamine?

The canonical SMILES is C1CC(C2=CC=CC=C2C1)CN.

What is the CAS number of 1,2,3,4-Tetrahydro-1-naphthalenemethanamine?

The CAS number is 91245-72-6.

How many hydrogen bond donor counts are there in 1,2,3,4-Tetrahydro-1-naphthalenemethanamine?

There is 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts are there in 1,2,3,4-Tetrahydro-1-naphthalenemethanamine?

There is 1 hydrogen bond acceptor count.