2-hydrazinyl-3-methoxypyrazine

• CAS: 210993-11-6
• Catalog Number: ACM210993116
• Category: Pyrazines
• Molecular Weight: 140.1
• Molecular Formula: C5H8N4O
• Appearance: Light yellow solid

Custom Q&A

What is the molecular formula of 2-hydrazinyl-3-methoxypyrazine?

The molecular formula of 2-hydrazinyl-3-methoxypyrazine is C5H8N4O.

What is the molecular weight of 2-hydrazinyl-3-methoxypyrazine?

The molecular weight of 2-hydrazinyl-3-methoxypyrazine is 140.14 g/mol.

What is the IUPAC name of 2-hydrazinyl-3-methoxypyrazine?

The IUPAC name of 2-hydrazinyl-3-methoxypyrazine is (3-methoxypyrazin-2-yl)hydrazine.

What is the InChI of 2-hydrazinyl-3-methoxypyrazine?

The InChI of 2-hydrazinyl-3-methoxypyrazine is InChI=1S/C5H8N4O/c1-10-5-4(9-6)7-2-3-8-5/h2-3H,6H2,1H3,(H,7,9).

What is the InChIKey of 2-hydrazinyl-3-methoxypyrazine?

The InChIKey of 2-hydrazinyl-3-methoxypyrazine is NWJRKRZUAOLPMO-UHFFFAOYSA-N.

What is the canonical SMILES of 2-hydrazinyl-3-methoxypyrazine?

The canonical SMILES of 2-hydrazinyl-3-methoxypyrazine is COC1=NC=CN=C1NN.

What is the CAS number of 2-hydrazinyl-3-methoxypyrazine?

The CAS number of 2-hydrazinyl-3-methoxypyrazine is 210993-11-6.

What is the XLogP3-AA value of 2-hydrazinyl-3-methoxypyrazine?

The XLogP3-AA value of 2-hydrazinyl-3-methoxypyrazine is -0.3.

How many hydrogen bond donor counts does 2-hydrazinyl-3-methoxypyrazine have?

2-hydrazinyl-3-methoxypyrazine has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 2-hydrazinyl-3-methoxypyrazine have?

2-hydrazinyl-3-methoxypyrazine has 5 hydrogen bond acceptor counts.