2-bromo-3-chloropyrazine

• CAS: 1206250-01-2
• Catalog Number: ACM1206250012
• Category: Pyrazines
• Molecular Weight: 191.9
• Molecular Formula: C4H2BrClN2
• Appearance: White Powder

Custom Q&A

What is the molecular formula of 2-bromo-3-chloropyrazine?

The molecular formula of 2-bromo-3-chloropyrazine is C4H2BrClN2.

What is the molecular weight of 2-bromo-3-chloropyrazine?

The molecular weight of 2-bromo-3-chloropyrazine is 193.43 g/mol.

What is the IUPAC name of 2-bromo-3-chloropyrazine?

The IUPAC name of 2-bromo-3-chloropyrazine is 2-bromo-3-chloropyrazine.

What is the InChI of 2-bromo-3-chloropyrazine?

The InChI of 2-bromo-3-chloropyrazine is InChI=1S/C4H2BrClN2/c5-3-4(6)8-2-1-7-3/h1-2H.

What is the InChIKey of 2-bromo-3-chloropyrazine?

The InChIKey of 2-bromo-3-chloropyrazine is OTZUKTGQTUYRCH-UHFFFAOYSA-N.

What is the canonical SMILES of 2-bromo-3-chloropyrazine?

The canonical SMILES of 2-bromo-3-chloropyrazine is C1=CN=C(C(=N1)Cl)Br.

What is the CAS number of 2-bromo-3-chloropyrazine?

The CAS number of 2-bromo-3-chloropyrazine is 1206250-01-2.

What is the EC number of 2-bromo-3-chloropyrazine?

The EC number of 2-bromo-3-chloropyrazine is 827-462-3.

What is the hydrogen bond donor count of 2-bromo-3-chloropyrazine?

The hydrogen bond donor count of 2-bromo-3-chloropyrazine is 0.

What is the hydrogen bond acceptor count of 2-bromo-3-chloropyrazine?

The hydrogen bond acceptor count of 2-bromo-3-chloropyrazine is 2.