(6-chloropyrazin-2-yl)methanamine

• CAS: 1357945-24-4
• Catalog Number: ACM1357945244
• Category: Pyrazines
• Molecular Weight: 143.0
• Molecular Formula: C5H6ClN3
• Appearance: Light yellow powder

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C5H6ClN3.

What is the molecular weight of the compound?

The molecular weight of the compound is 143.57 g/mol.

When was the compound first created?

The compound was first created on January 24, 2012.

What is the IUPAC name of the compound?

The IUPAC name of the compound is (6-chloropyrazin-2-yl)methanamine.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C5H6ClN3/c6-5-3-8-2-4(1-7)9-5/h2-3H,1,7H2.

What is the InChIKey of the compound?

The InChIKey of the compound is ODFNSYFUAVUKRF-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is C1=C(N=C(C=N1)Cl)CN.

What is the CAS number of the compound?

The CAS number of the compound is 1060814-52-9.

What is the hydrogen bond donor count of the compound?

The compound has 1 hydrogen bond donor.

Does the compound have any defined bond stereocenter count?

No, the compound does not have any defined bond stereocenter count.