methyl 6-bromo-5-methylpyrazine-2-carboxylate

• CAS: 1166827-91-3
• Catalog Number: ACM1166827913
• Category: Pyrazines
• Molecular Weight: 230.0
• Molecular Formula: C7H7BrN2O2
• Appearance: Off-white Powder

Custom Q&A

What is the molecular formula of methyl 6-bromo-5-methylpyrazine-2-carboxylate?

The molecular formula is C7H7BrN2O2.

What is the molecular weight of methyl 6-bromo-5-methylpyrazine-2-carboxylate?

The molecular weight is 231.05 g/mol.

What is the IUPAC name of methyl 6-bromo-5-methylpyrazine-2-carboxylate?

The IUPAC name is methyl 6-bromo-5-methylpyrazine-2-carboxylate.

What is the InChI of methyl 6-bromo-5-methylpyrazine-2-carboxylate?

The InChI is InChI=1S/C7H7BrN2O2/c1-4-6(8)10-5(3-9-4)7(11)12-2/h3H,1-2H3.

What is the InChIKey of methyl 6-bromo-5-methylpyrazine-2-carboxylate?

The InChIKey is TZPBBQPUHKINGG-UHFFFAOYSA-N.

What is the canonical SMILES of methyl 6-bromo-5-methylpyrazine-2-carboxylate?

The canonical SMILES is CC1=NC=C(N=C1Br)C(=O)OC.

What is the XLogP3-AA value of methyl 6-bromo-5-methylpyrazine-2-carboxylate?

The XLogP3-AA value is 1.4.

How many hydrogen bond donor count does methyl 6-bromo-5-methylpyrazine-2-carboxylate have?

It has a hydrogen bond donor count of 0.

How many hydrogen bond acceptor count does methyl 6-bromo-5-methylpyrazine-2-carboxylate have?

It has a hydrogen bond acceptor count of 4.

What is the topological polar surface area of methyl 6-bromo-5-methylpyrazine-2-carboxylate?

The topological polar surface area is 52.1 ?2.