2-Carboxythiophene-3-boronic acid

• CAS: 5503-74-2
• Catalog Number: ACM5503742
• Category: Boronic Acids
• Molecular Weight: 171.97
• Molecular Formula: C₅H₅BO₄S
• Synonyms: 3-BORONO-2-THIOPHENECARBOXYLIC ACID;RARECHEM AL BE 0854;3-(Dihydroxyboryl)-2-thiophenecarboxylic acid

Custom Q&A

What is the molecular formula of 2-Carboxythiophene-3-boronic acid?

The molecular formula is C5H5BO4S.

What is the molecular weight of 2-Carboxythiophene-3-boronic acid?

The molecular weight is 171.97 g/mol.

What is the IUPAC name of 2-Carboxythiophene-3-boronic acid?

The IUPAC name is 3-boronothiophene-2-carboxylic acid.

What is the InChI of 2-Carboxythiophene-3-boronic acid?

The InChI is InChI=1S/C5H5BO4S/c7-5(8)4-3(6(9)10)1-2-11-4/h1-2,9-10H,(H,7,8).

What is the InChIKey of 2-Carboxythiophene-3-boronic acid?

The InChIKey is AJNCKPIBBSWSBY-UHFFFAOYSA-N.

What is the canonical SMILES of 2-Carboxythiophene-3-boronic acid?

The canonical SMILES is B(C1=C(SC=C1)C(=O)O)(O)O.

What is the CAS number of 2-Carboxythiophene-3-boronic acid?

The CAS number is 5503-74-2.

How many hydrogen bond donor counts are there in 2-Carboxythiophene-3-boronic acid?

There are 3 hydrogen bond donor counts.

How many hydrogen bond acceptor counts are there in 2-Carboxythiophene-3-boronic acid?

There are 5 hydrogen bond acceptor counts.