CAS
1218790-71-6 Purity
---
1218790-71-6 Purity
---
Inquiry Basket
4-Chloro-2-fluoro-3-methylphenylboronic acid
CAS
944128-92-1
Catalog Number
ACM944128921
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 4-Chloro-2-fluoro-3-methylphenylboronic acid?
The molecular formula of 4-Chloro-2-fluoro-3-methylphenylboronic acid is C7H7BClFO2.
What is the synonyms for 4-Chloro-2-fluoro-3-methylphenylboronic acid?
The synonyms for 4-Chloro-2-fluoro-3-methylphenylboronic acid are 944128-92-1, (4-Chloro-2-fluoro-3-methylphenyl)boronic acid, 4-Chloro-2-fluoro-3-methylphenylboronic acid MFCD18447609, and SCHEMBL1224426.
What is the molecular weight of 4-Chloro-2-fluoro-3-methylphenylboronic acid?
The molecular weight of 4-Chloro-2-fluoro-3-methylphenylboronic acid is 188.39 g/mol.
What is the IUPAC name of 4-Chloro-2-fluoro-3-methylphenylboronic acid?
The IUPAC name of 4-Chloro-2-fluoro-3-methylphenylboronic acid is (4-chloro-2-fluoro-3-methylphenyl)boronic acid.
What is the InChI of 4-Chloro-2-fluoro-3-methylphenylboronic acid?
The InChI of 4-Chloro-2-fluoro-3-methylphenylboronic acid is InChI=1S/C7H7BClFO2/c1-4-6(9)3-2-5(7(4)10)8(11)12/h2-3,11-12H,1H3.
What is the InChIKey of 4-Chloro-2-fluoro-3-methylphenylboronic acid?
The InChIKey of 4-Chloro-2-fluoro-3-methylphenylboronic acid is GEQUDJQVXRZIIK-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Chloro-2-fluoro-3-methylphenylboronic acid?
The canonical SMILES of 4-Chloro-2-fluoro-3-methylphenylboronic acid is B(C1=C(C(=C(C=C1)Cl)C)F)(O)O.
What is the CAS number of 4-Chloro-2-fluoro-3-methylphenylboronic acid?
The CAS number of 4-Chloro-2-fluoro-3-methylphenylboronic acid is 944128-92-1.
What is the hydrogen bond donor count for 4-Chloro-2-fluoro-3-methylphenylboronic acid?
The hydrogen bond donor count for 4-Chloro-2-fluoro-3-methylphenylboronic acid is 2.
What is the hydrogen bond acceptor count for 4-Chloro-2-fluoro-3-methylphenylboronic acid?
The hydrogen bond acceptor count for 4-Chloro-2-fluoro-3-methylphenylboronic acid is 3.
Recommended Products
