(S)-3-Amino-4-(1-naphthyl)butanoic acid hydrochloride

• Catalog Number: ACMA00001121
• Category: Amines
• Molecular Weight: 265.74
• Molecular Formula: C₁₄H₁₅NO₂
• Hazard Statements: H315-H319-H335
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the PubChem CID of the compound?

The PubChem CID of the compound is 2761617.

What is the molecular formula of the compound?

The molecular formula of the compound is C14H16ClNO2.

What are the synonyms of the compound?

The synonyms of the compound are (S)-3-Amino-4-(naphthalen-1-yl)butanoic acid hydrochloride, 331846-99-2, 270063-00-8, (S)-3-Amino-4-(1-naphthyl)-butyric acid-HCl, (S)-3-AMINO-4-(1-NAPHTHYL)BUTANOIC ACID HYDROCHLORIDE.

What is the molecular weight of the compound?

The molecular weight of the compound is 265.73 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is (3S)-3-amino-4-naphthalen-1-ylbutanoic acid hydrochloride.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C14H15NO2.ClH/c15-12(9-14(16)17)8-11-6-3-5-10-4-1-2-7-13(10)11;/h1-7,12H,8-9,15H2,(H,16,17);1H/t12-;/m0./s1.

What is the InChIKey of the compound?

The InChIKey of the compound is AZXBBARHJITLTI-YDALLXLXSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is C1=CC=C2C(=C1)C=CC=C2CC(CC(=O)O)N.Cl.

How many hydrogen bond donor count does the compound have?

The compound has a hydrogen bond donor count of 3.

How many hydrogen bond acceptor count does the compound have?

The compound has a hydrogen bond acceptor count of 3.