2-(2-Formyl-6-methoxyphenoxy)acetic acid

• Catalog Number: ACMA00002061
• Category: Ethers
• Molecular Weight: 210.18
• Molecular Formula: C₁₀H₁₀O₄
• Hazard Statements: H301
• RIDADR: NONH for all modes of transport
• Symbol: GHS06

Custom Q&A

What is the molecular formula of 2-(2-formyl-6-methoxyphenoxy)acetic acid?

The molecular formula of 2-(2-formyl-6-methoxyphenoxy)acetic acid is C10H10O5.

What is the molecular weight of 2-(2-formyl-6-methoxyphenoxy)acetic acid?

The molecular weight of 2-(2-formyl-6-methoxyphenoxy)acetic acid is 210.18 g/mol.

What is the IUPAC name of 2-(2-formyl-6-methoxyphenoxy)acetic acid?

The IUPAC name of 2-(2-formyl-6-methoxyphenoxy)acetic acid is 2-(2-formyl-6-methoxyphenoxy)acetic acid.

What is the Canonical SMILES representation of 2-(2-formyl-6-methoxyphenoxy)acetic acid?

The Canonical SMILES representation of 2-(2-formyl-6-methoxyphenoxy)acetic acid is COC1=CC=CC(=C1OCC(=O)O)C=O.

What is the InChIKey of 2-(2-formyl-6-methoxyphenoxy)acetic acid?

The InChIKey of 2-(2-formyl-6-methoxyphenoxy)acetic acid is STGBYWNNAZDMFE-UHFFFAOYSA-N.

How many hydrogen bond donor counts are there in 2-(2-formyl-6-methoxyphenoxy)acetic acid?

There is 1 hydrogen bond donor count in 2-(2-formyl-6-methoxyphenoxy)acetic acid.

How many hydrogen bond acceptor counts are there in 2-(2-formyl-6-methoxyphenoxy)acetic acid?

There are 5 hydrogen bond acceptor counts in 2-(2-formyl-6-methoxyphenoxy)acetic acid.

What is the topological polar surface area of 2-(2-formyl-6-methoxyphenoxy)acetic acid?

The topological polar surface area of 2-(2-formyl-6-methoxyphenoxy)acetic acid is 72.8 Ų.

Is 2-(2-formyl-6-methoxyphenoxy)acetic acid a canonicalized compound?

Yes, 2-(2-formyl-6-methoxyphenoxy)acetic acid is a canonicalized compound.

What is the complexity value of 2-(2-formyl-6-methoxyphenoxy)acetic acid?

The complexity value of 2-(2-formyl-6-methoxyphenoxy)acetic acid is 228.