CAS
--- Purity
---
--- Purity
---
Inquiry Basket
2-Formyl-4,5-dimethoxy-benzoic acid
Catalog Number
ACMA00002060
Category
Ethers
Molecular Weight
210.18
Molecular Formula
C10H10O4
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H302
RIDADR
NONH for all modes of transport
Symbol
GHS07
What is the molecular formula of the compound?
The molecular formula of the compound is C10H10O5.
What is the molecular weight of the compound?
The molecular weight of the compound is 210.18 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 2-formyl-4,5-dimethoxybenzoic acid.
What is the InChI key of the compound?
The InChI key of the compound is CXANNUKKXKKTKG-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is COC1=C(C=C(C(=C1)C=O)C(=O)O)OC.
What is the CAS number of the compound?
The CAS number of the compound is 490-63-1.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 0.9.
How many hydrogen bond donor counts does the compound have?
The compound has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does the compound have?
The compound has 5 hydrogen bond acceptor counts.
How many rotatable bond counts does the compound have?
The compound has 4 rotatable bond counts.
Recommended Products
