2-(2-Formyl-4-methoxyphenoxy)acetic acid

• Catalog Number: ACMA00002059
• Category: Ethers
• Molecular Weight: 210.18
• Molecular Formula: C₁₀H₁₀O₄
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C10H10O5.

What is the molecular weight of the compound?

The molecular weight of the compound is 210.18 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 2-(2-formyl-4-methoxyphenoxy)acetic acid.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C10H10O5/c1-14-8-2-3-9(7(4-8)5-11)15-6-10(12)13/h2-5H,6H2,1H3,(H,12,13).

What is the InChIKey of the compound?

The InChIKey of the compound is BTPORJVAKLIAGD-UHFFFAOYSA-N.

What is the CAS number of the compound?

The CAS number of the compound is 24589-93-3.

What is the European Community (EC) number of the compound?

The European Community (EC) number of the compound is 865-659-6.

How many hydrogen bond donor counts does the compound have?

The compound has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does the compound have?

The compound has 5 hydrogen bond acceptor counts.

How many rotatable bond counts does the compound have?

The compound has 5 rotatable bond counts.