CAS
--- Purity
---
--- Purity
---
Inquiry Basket
3-(4-Hydroxy-3-methoxyphenyl)-2-oxopropanoic acid
Catalog Number
ACMA00002063
Category
Ethers
Molecular Weight
210.18
Molecular Formula
C10H10O4
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H301
RIDADR
NONH for all modes of transport
Symbol
GHS06
What is the molecular formula of vanilpyruvic acid?
The molecular formula of vanilpyruvic acid is C10H10O5.
What are some synonyms of vanilpyruvic acid?
Some synonyms of vanilpyruvic acid are 4-Hydroxy-3-methoxyphenylpyruvic acid and Vanylpyruvic acid.
What is the molecular weight of vanilpyruvic acid?
The molecular weight of vanilpyruvic acid is 210.18 g/mol.
What is the IUPAC name of vanilpyruvic acid?
The IUPAC name of vanilpyruvic acid is 3-(4-hydroxy-3-methoxyphenyl)-2-oxopropanoic acid.
What is the InChIKey of vanilpyruvic acid?
The InChIKey of vanilpyruvic acid is YGQHQTMRZPHIBB-UHFFFAOYSA-N.
What is the canonical SMILES representation of vanilpyruvic acid?
The canonical SMILES representation of vanilpyruvic acid is COC1=C(C=CC(=C1)CC(=O)C(=O)O).
How many hydrogen bond donor counts does vanilpyruvic acid have?
Vanilpyruvic acid has 2 hydrogen bond donor counts.
What is the topological polar surface area of vanilpyruvic acid?
The topological polar surface area of vanilpyruvic acid is 83.8Ų.
What is the exact mass and monoisotopic mass of vanilpyruvic acid?
The exact mass and monoisotopic mass of vanilpyruvic acid are 210.05282342 g/mol.
What is the complexity of vanilpyruvic acid?
The complexity of vanilpyruvic acid is 250.
Recommended Products
