(R)-BoroAla-(+)-Pinanediol

• CAS: 497165-15-8
• Catalog Number: ACM497165158
• Category: Boro-Amino Acids
• Molecular Formula: C₁₂H₂₂BNO₂

Custom Q&A

What is the molecular formula of (R)-BoroAla-(+)-Pinanediol?

The molecular formula is C12H22BNO2.

What is the molecular weight of (R)-BoroAla-(+)-Pinanediol?

The molecular weight is 223.12 g/mol.

What is the IUPAC name of (R)-BoroAla-(+)-Pinanediol?

The IUPAC name is (1R)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine.

What is the InChI of (R)-BoroAla-(+)-Pinanediol?

The InChI is InChI=1S/C12H22BNO2/c1-7(14)13-15-10-6-8-5-9(11(8,2)3)12(10,4)16-13/h7-10H,5-6,14H2,1-4H3/t7-,8-,9-,10+,12-/m0/s1.

What is the InChIKey of (R)-BoroAla-(+)-Pinanediol?

The InChIKey is AKMVYVLKQCECJH-GBVMLCMLSA-N.

What is the canonical SMILES of (R)-BoroAla-(+)-Pinanediol?

The canonical SMILES is B1(OC2CC3CC(C3(C)C)C2(O1)C)C(C)N.

How many hydrogen bond donor counts does (R)-BoroAla-(+)-Pinanediol have?

It has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does (R)-BoroAla-(+)-Pinanediol have?

It has 3 hydrogen bond acceptor counts.

What is the topological polar surface area of (R)-BoroAla-(+)-Pinanediol?

The topological polar surface area is 44.5Ų.

How many defined atom stereocenter counts does (R)-BoroAla-(+)-Pinanediol have?

It has 5 defined atom stereocenter counts.