(R)-BoroPhe-(+)-Pinanediol-CF3CO2H

• CAS: 514820-49-6
• Catalog Number: ACM514820496
• Category: Boro-Amino Acids
• Molecular Weight: 413.24
• Molecular Formula: C₁₈H₂₆BNO₂.C₂HF₃O₂

Custom Q&A

What is the PubChem CID number for (R)-BoroPhe-(+)-Pinanediol-CF3CO2H?

PubChem CID: 74764070

What is the molecular formula of (R)-BoroPhe-(+)-Pinanediol-CF3CO2H?

Molecular Formula: C20H27BF3NO4

What is the molecular weight of (R)-BoroPhe-(+)-Pinanediol-CF3CO2H?

Molecular Weight: 413.2 g/mol

What is the IUPAC name of (R)-BoroPhe-(+)-Pinanediol-CF3CO2H?

IUPAC Name: 2-phenyl-1-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.0 2,6 ]decan-4-yl)ethanamine;2,2,2-trifluoroacetic acid

What is the InChI of (R)-BoroPhe-(+)-Pinanediol-CF3CO2H?

InChI: InChI=1S/C18H26BNO2.C2HF3O2/c1-17(2)13-10-14(17)18(3)15(11-13)21-19(22-18)16(20)9-12-7-5-4-6-8-12;3-2(4,5)1(6)7/h4-8,13-16H,9-11,20H2,1-3H3;(H,6,7)

What is the InChIKey of (R)-BoroPhe-(+)-Pinanediol-CF3CO2H?

InChIKey: YJRYQGLPPMUWRO-UHFFFAOYSA-N

What is the Canonical SMILES of (R)-BoroPhe-(+)-Pinanediol-CF3CO2H?

Canonical SMILES: B1(OC2CC3CC(C3(C)C)C2(O1)C)C(CC4=CC=CC=C4)N.C(=O)(C(F)(F)F)O

How many hydrogen bond donor counts does (R)-BoroPhe-(+)-Pinanediol-CF3CO2H have?

Hydrogen Bond Donor Count: 2

How many hydrogen bond acceptor counts does (R)-BoroPhe-(+)-Pinanediol-CF3CO2H have?

Hydrogen Bond Acceptor Count: 8

What is the topological polar surface area of (R)-BoroPhe-(+)-Pinanediol-CF3CO2H?

Topological Polar Surface Area: 81.8Ų