4-((N-boc-amino)methyl)phenylboronic acid

• CAS: 489446-42-6
• Catalog Number: ACM489446426
• Category: Boro-Amino Acids
• Molecular Weight: 251.09
• Molecular Formula: C₁₂H₁₈BNO₄

Custom Q&A

What is the molecular formula of 4-((N-boc-amino)methyl)phenylboronic acid?

The molecular formula is C12H18BNO4.

When was the compound created and last modified in PubChem?

The compound was created on September 12, 2005, and last modified on December 2, 2023.

What is the IUPAC name of the compound?

The IUPAC name is [4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]boronic acid.

What is the Canonical SMILES of the compound?

The Canonical SMILES is B(C1=CC=C(C=C1)CNC(=O)OC(C)(C)C)(O)O.

What is the InChIKey of the compound?

The InChIKey is MUBGEKQUCSEECZ-UHFFFAOYSA-N.

What is the molecular weight of 4-((N-boc-amino)methyl)phenylboronic acid?

The molecular weight is 251.09 g/mol.

How many hydrogen bond donor counts does the compound have?

The compound has 3 hydrogen bond donor counts.

What is the exact mass of the compound?

The exact mass is 251.1328882 g/mol.

How many hydrogen bond acceptor counts does the compound have?

The compound has 4 hydrogen bond acceptor counts.

Is the compound canonicalized in PubChem?

Yes, the compound is canonicalized in PubChem.