Sorivudine

• CAS: 77181-69-2
• Catalog Number: ACM77181692
• Category: Inhibitors
• Molecular Weight: 349.136
• Molecular Formula: C₁₁H₁₃BrN₂O₆
• Description: Sorivudine (BV-araU) is an orally active synthetic pyrimidine nucleoside antimetabolite agent. Sorivudine derives its antiviral activity from selective conversion by a specific thymidine kinase present in certain DNA viruses to nucleotides, which can in turn interfere with viral DNA synthesis.
• Synonyms: sorivudine;1-(β-D-Arabinofuranosyl)-5-[(E)-2-bromoethenyl]uracil;1-β-D-Arabinofuranosyl-5-[(E)-2-bromovinyl]-1,2,3,4-tetrahydropyrimidine-2,4-dione;Brovavir;BvAraU;BV-araU;YN-72;Bravavir
• Canonical SMILES: O=C1NC(C(/C=C/Br)=CN1[C@H]2[C@H]([C@@H]([C@@H](CO)O2)O)O)=O
• Appearance: Solid
• Storage: Powder-20°C, 3 years; 4°C, 2 years; In solvent-80°C, 6 months; -20°C, 1 month.
• Shipping: Can be shipped at room temperature, where not in use may vary.

Custom Q&A

What is the molecular formula of sorivudine?

The molecular formula of sorivudine is C11H13BrN2O6.

What is the molecular weight of sorivudine?

The molecular weight of sorivudine is 349.13 g/mol.

What is the IUPAC name of sorivudine?

The IUPAC name of sorivudine is 5-[(E)-2-bromoethenyl]-1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.

How does sorivudine interfere with viral DNA replication?

Sorivudine interferes with viral DNA replication by inhibiting DNA polymerase activity without being incorporated into elongating viral DNA.

Why was sorivudine removed from the market?

Sorivudine was removed from the market due to dangerous effects of drug-drug interactions via its metabolite.

What is the InChIKey of sorivudine?

The InChIKey of sorivudine is GCQYYIHYQMVWLT-HQNLTJAPSA-N.

What is the canonical SMILES representation of sorivudine?

The canonical SMILES representation of sorivudine is C1=C(C(=O)NC(=O)N1C2C(C(C(O2)CO)O)O)C=CBr.

What is the XLogP3 value of sorivudine?

The XLogP3 value of sorivudine is -0.9.

How many hydrogen bond donor counts does sorivudine have?

Sorivudine has 4 hydrogen bond donor counts.

What is the topological polar surface area of sorivudine?

The topological polar surface area of sorivudine is 119 Ų.