Potassium trifluoro[(pyrrolidin-1-yl)methyl]borate

• CAS: 888711-53-3
• Catalog Number: ACM888711533
• Category: Borate
• Molecular Formula: C₅H₁₀BF₃N.K

Custom Q&A

What is the molecular formula of Potassium trifluoro[(pyrrolidin-1-yl)methyl]borate?

The molecular formula is C5H10BF3KN.

What is the molecular weight of Potassium trifluoro[(pyrrolidin-1-yl)methyl]borate?

The molecular weight is 191.05 g/mol.

What is the IUPAC name of Potassium trifluoro[(pyrrolidin-1-yl)methyl]borate?

The IUPAC name is potassium;trifluoro(pyrrolidin-1-ylmethyl)boranuide.

What is the InChI of Potassium trifluoro[(pyrrolidin-1-yl)methyl]borate?

The InChI is InChI=1S/C5H10BF3N.K/c7-6(8,9)5-10-3-1-2-4-10;/h1-5H2;/q-1;+1.

What is the InChIKey of Potassium trifluoro[(pyrrolidin-1-yl)methyl]borate?

The InChIKey is IPPVCGNMEPSDMN-UHFFFAOYSA-N.

What is the canonical SMILES of Potassium trifluoro[(pyrrolidin-1-yl)methyl]borate?

The canonical SMILES is [B-](CN1CCCC1)(F)(F)F.[K+].

What is the CAS number of Potassium trifluoro[(pyrrolidin-1-yl)methyl]borate?

The CAS number is 888711-53-3.

What is the European Community (EC) number of Potassium trifluoro[(pyrrolidin-1-yl)methyl]borate?

The EC number is 678-778-1.

How many hydrogen bond donor counts does Potassium trifluoro[(pyrrolidin-1-yl)methyl]borate have?

It has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does Potassium trifluoro[(pyrrolidin-1-yl)methyl]borate have?

It has 5 hydrogen bond acceptor counts.