Potassium trifluoro[(thien-2-yl)methyl]borate

• CAS: 888711-49-7
• Catalog Number: ACM888711497
• Category: Borate
• Molecular Formula: C₅H₅BF₃S.K

Custom Q&A

What is the molecular formula of Potassium trifluoro[(thien-2-yl)methyl]borate?

The molecular formula is C5H5BF3KS.

What is the molecular weight of Potassium trifluoro[(thien-2-yl)methyl]borate?

The molecular weight is 204.07 g/mol.

What is the IUPAC name of Potassium trifluoro[(thien-2-yl)methyl]borate?

The IUPAC name is potassium;trifluoro(thiophen-2-ylmethyl)boranuide.

What is the InChI of Potassium trifluoro[(thien-2-yl)methyl]borate?

The InChI is InChI=1S/C5H5BF3S.K/c7-6(8,9)4-5-2-1-3-10-5;/h1-3H,4H2;/q-1;+1.

What is the InChIKey of Potassium trifluoro[(thien-2-yl)methyl]borate?

The InChIKey is ZQXVXPIJXQWYQG-UHFFFAOYSA-N.

What is the canonical SMILES of Potassium trifluoro[(thien-2-yl)methyl]borate?

The canonical SMILES is [B-](CC1=CC=CS1)(F)(F)F.[K+].

What is the CAS number of Potassium trifluoro[(thien-2-yl)methyl]borate?

The CAS number is 888711-49-7.

What is the molecular weight of Potassium?

The molecular weight of Potassium is not provided in the reference.

How many hydrogen bond donor counts are there in Potassium trifluoro[(thien-2-yl)methyl]borate?

There are 0 hydrogen bond donor counts in Potassium trifluoro[(thien-2-yl)methyl]borate.

How many hydrogen bond acceptor counts are there in Potassium trifluoro[(thien-2-yl)methyl]borate?

There are 5 hydrogen bond acceptor counts in Potassium trifluoro[(thien-2-yl)methyl]borate.