Potassium trifluoro(4-methoxybenzyl)borate

• CAS: 900810-91-5
• Catalog Number: ACM900810915
• Category: Borate
• Molecular Formula: C8H9BF3O.K

Custom Q&A

What is the molecular formula of Potassium trifluoro(4-methoxybenzyl)borate?

The molecular formula is C8H9BF3KO.

What is the molecular weight of Potassium trifluoro(4-methoxybenzyl)borate?

The molecular weight is 228.06 g/mol.

What are the synonyms of Potassium trifluoro(4-methoxybenzyl)borate?

The synonyms are Potassium trifluoro(4-methoxybenzyl)borate, potassium;trifluoro-[(4-methoxyphenyl)methyl]boranuide, DTXSID40672220, MFCD09993297.

What is the IUPAC name of Potassium trifluoro(4-methoxybenzyl)borate?

The IUPAC name is potassium;trifluoro-[(4-methoxyphenyl)methyl]boranuide.

What is the InChI of Potassium trifluoro(4-methoxybenzyl)borate?

The InChI is InChI=1S/C8H9BF3O.K/c1-13-8-4-2-7(3-5-8)6-9(10,11)12;/h2-5H,6H2,1H3;/q-1;+1.

What is the InChIKey of Potassium trifluoro(4-methoxybenzyl)borate?

The InChIKey is HCVMFMOAPUMWGJ-UHFFFAOYSA-N.

What is the canonical SMILES of Potassium trifluoro(4-methoxybenzyl)borate?

The canonical SMILES is [B-](CC1=CC=C(C=C1)OC)(F)(F)F.[K+].

What is the CAS number of Potassium trifluoro(4-methoxybenzyl)borate?

The CAS number is 900810-91-5.

What is the hydrogen bond donor count of Potassium trifluoro(4-methoxybenzyl)borate?

The hydrogen bond donor count is 0.

Is Potassium trifluoro(4-methoxybenzyl)borate a canonicalized compound?

Yes, it is a canonicalized compound.