Naphtanilide EL

CAS

137-52-0

Catalog Number

ACM137520

Category

Azoic Dyes

Molecular Weight

327.76

Molecular Formula

C₁₈H₁₄ClNO₃

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

Specification

Synonyms

5'-chloro-3-hydroxy-2'-methoxy-2-naphthanilide;azoiccouplingcomponent34;n-(5-chloro-2-methoxyphenyl)-3-hydroxy-2-naphthalenecarboxamid;N-(5-chloro-2-methoxyphenyl)-3-hydroxy-2-Naphthalenecarboxamide;NAPTHOL AS-LC;NAPHTOL AS-LC;NAPHTHOL AS-CL;NAPHTHOL AS-

Density

1.384 g/cm³

What is the PubChem CID of Naphtanilide EL?

The PubChem CID of Naphtanilide EL is 67305.

What is the molecular formula of Naphtanilide EL?

The molecular formula of Naphtanilide EL is C18H14ClNO3.

What are the synonyms of Naphtanilide EL?

The synonyms of Naphtanilide EL include 137-52-0, n-(5-chloro-2-methoxyphenyl)-3-hydroxy-2-naphthamide, Naphtanilide EL, N-(5-chloro-2-methoxyphenyl)-3-hydroxynaphthalene-2-carboxamide, Naphthol AS-CA, and more.

What is the molecular weight of Naphtanilide EL?

The molecular weight of Naphtanilide EL is 327.8 g/mol.

What is the IUPAC name of Naphtanilide EL?

The IUPAC name of Naphtanilide EL is N-(5-chloro-2-methoxyphenyl)-3-hydroxynaphthalene-2-carboxamide.

What is the InChI of Naphtanilide EL?

The InChI of Naphtanilide EL is InChI=1S/C18H14ClNO3/c1-23-17-7-6-13(19)10-15(17)20-18(22)14-8-11-4-2-3-5-12(11)9-16(14)21/h2-10,21H,1H3,(H,20,22).

What is the InChIKey of Naphtanilide EL?

The InChIKey of Naphtanilide EL is WWXPGBMLOCYWLD-UHFFFAOYSA-N.

What is the canonical SMILES of Naphtanilide EL?

The canonical SMILES of Naphtanilide EL is COC1=C(C=C(C=C1)Cl)NC(=O)C2=CC3=CC=CC=C3C=C2O.

What is the CAS number of Naphtanilide EL?

The CAS number of Naphtanilide EL is 137-52-0.

How many hydrogen bond donor counts does Naphtanilide EL have?

Naphtanilide EL has 2 hydrogen bond donor counts.

What are some synonyms of Naphtanilide EL?

Some synonyms of Naphtanilide EL include 137-52-0, n-(5-chloro-2-methoxyphenyl)-3-hydroxy-2-naphthamide, N-(5-chloro-2-methoxyphenyl)-3-hydroxynaphthalene-2-carboxamide, and Naphthol AS-CA.

What is the molecular weight, XLogP3-AA, hydrogen bond donor count, hydrogen bond acceptor count, rotatable bond count, exact mass, monoisotopic mass, topological polar surface area, heavy atom count, formal charge, complexity, isotope atom count, defined atom stereocenter count, undefined atom stereocenter count, defined bond stereocenter count, undefined bond stereocenter count, and covalently-bonded unit count of Naphtanilide EL?

The molecular weight of Naphtanilide EL is 327.8 g/mol.
The XLogP3-AA value of Naphtanilide EL is 4.8.
The hydrogen bond donor count of Naphtanilide EL is 2.
The hydrogen bond acceptor count of Naphtanilide EL is 3.
The rotatable bond count of Naphtanilide EL is 3.
The exact mass of Naphtanilide EL is 327.0662210 g/mol.
The monoisotopic mass of Naphtanilide EL is 327.0662210 g/mol.
The topological polar surface area of Naphtanilide EL is 58.6 ?2.
The heavy atom count of Naphtanilide EL is 23.
The formal charge of Naphtanilide EL is 0.
The complexity of Naphtanilide EL is 419.
The isotope atom count of Naphtanilide EL is 0.
The defined atom stereocenter count of Naphtanilide EL is 0.
The undefined atom stereocenter count of Naphtanilide EL is 0.
The defined bond stereocenter count of Naphtanilide EL is 0.
The undefined bond stereocenter count of Naphtanilide EL is 0.
The covalently-bonded unit count of Naphtanilide EL is 1.