3-Hydroxy-N-2-naphthyl-2-naphthamide

CAS

135-64-8

Catalog Number

ACM135648

Category

Azoic Dyes

Molecular Weight

313.35

Molecular Formula

C₂₁H₁₅NO₂

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

Specification

Synonyms

Azoic coupling component 7;3-Hydroxy-N-2-naphthyl-2-naphthamide;Naphthol AS-SW (3-Hydroxy-n-(2'-naphthyl)-2-naphthamide);Naphthol AS-SW

Density

1.333g/cm³

What is the molecular formula of 3-Hydroxy-N-2-naphthyl-2-naphthamide?

The molecular formula of 3-Hydroxy-N-2-naphthyl-2-naphthamide is C21H15NO2.

What is the molecular weight of 3-Hydroxy-N-2-naphthyl-2-naphthamide?

The molecular weight of 3-Hydroxy-N-2-naphthyl-2-naphthamide is 313.3 g/mol.

What is the IUPAC Name of 3-Hydroxy-N-2-naphthyl-2-naphthamide?

The IUPAC Name of 3-Hydroxy-N-2-naphthyl-2-naphthamide is 3-hydroxy-N-naphthalen-2-ylnaphthalene-2-carboxamide.

What is the InChI of 3-Hydroxy-N-2-naphthyl-2-naphthamide?

The InChI of 3-Hydroxy-N-2-naphthyl-2-naphthamide is InChI=1S/C21H15NO2/c23-20-13-17-8-4-3-7-16(17)12-19(20)21(24)22-18-10-9-14-5-1-2-6-15(14)11-18/h1-13,23H,(H,22,24).

What is the InChIKey of 3-Hydroxy-N-2-naphthyl-2-naphthamide?

The InChIKey of 3-Hydroxy-N-2-naphthyl-2-naphthamide is PMYDPQQPEAYXKD-UHFFFAOYSA-N.

What is the canonical SMILES of 3-Hydroxy-N-2-naphthyl-2-naphthamide?

The canonical SMILES of 3-Hydroxy-N-2-naphthyl-2-naphthamide is C1=CC=C2C=C(C=CC2=C1)NC(=O)C3=CC4=CC=CC=C4C=C3O.

What is the CAS number of 3-Hydroxy-N-2-naphthyl-2-naphthamide?

The CAS number of 3-Hydroxy-N-2-naphthyl-2-naphthamide is 135-64-8.

What is the molecular weight of 3-Hydroxy-N-2-naphthyl-2-naphthamide according to PubChem?

The molecular weight of 3-Hydroxy-N-2-naphthyl-2-naphthamide is 313.3 g/mol according to PubChem.

What is the XLogP3-AA value of 3-Hydroxy-N-2-naphthyl-2-naphthamide?

The XLogP3-AA value of 3-Hydroxy-N-2-naphthyl-2-naphthamide is 5.5.

How many hydrogen bond donor counts does 3-Hydroxy-N-2-naphthyl-2-naphthamide have?

3-Hydroxy-N-2-naphthyl-2-naphthamide has 2 hydrogen bond donor counts.

How many hydrogen bond donor counts are there in 3-Hydroxy-N-2-naphthyl-2-naphthamide?

There are 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts are there in 3-Hydroxy-N-2-naphthyl-2-naphthamide?

There are 2 hydrogen bond acceptor counts.