Azoic Diazo Component 34

CAS

16047-24-8

Catalog Number

ACM16047248

Category

Azoic Dyes

Molecular Weight

164.14

Molecular Formula

C₇H₆N₃O₂

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

Specification

Synonyms

3-METHYL-4-NITROBENZENEDIAZONIUM TETRAFLUOROBORATE;2-Methyl-4-nitrobenzenediazonium;diazo fast red rl;FAST RED RL SALT;Azoic Diazo Component 34;2-methyl-4-nitro-benzenediazoniu;2-Diazo-5-nitrotoluene;Benzenediazonium, 2-methyl-4-nitro

Density

g/cm³

What is the molecular formula of Azoic Diazo Component 34?

The molecular formula of Azoic Diazo Component 34 is C7H6N3O2+.

What is the molecular weight of Azoic Diazo Component 34?

The molecular weight of Azoic Diazo Component 34 is 164.14 g/mol.

What is the IUPAC name of Azoic Diazo Component 34?

The IUPAC name of Azoic Diazo Component 34 is 2-methyl-4-nitrobenzenediazonium.

What is the InChIKey of Azoic Diazo Component 34?

The InChIKey of Azoic Diazo Component 34 is RNBOFGSATMLBRI-UHFFFAOYSA-N.

What is the canonical SMILES of Azoic Diazo Component 34?

The canonical SMILES of Azoic Diazo Component 34 is CC1=C(C=CC(=C1)[N+](=O)[O-])[N+]#N.

What is the CAS number of Azoic Diazo Component 34?

The CAS number of Azoic Diazo Component 34 is 16047-24-8.

What is the UNII of Azoic Diazo Component 34?

The UNII of Azoic Diazo Component 34 is W6Z4EKF9JA.

What is the XLogP3-AA value of Azoic Diazo Component 34?

The XLogP3-AA value of Azoic Diazo Component 34 is 2.8.

How many hydrogen bond donor counts does Azoic Diazo Component 34 have?

Azoic Diazo Component 34 has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does Azoic Diazo Component 34 have?

Azoic Diazo Component 34 has 3 hydrogen bond acceptor counts.

What is the InChI of Azoic Diazo Component 34?

The InChI of Azoic Diazo Component 34 is InChI=1S/C7H6N3O2/c1-5-4-6(10(11)12)2-3-7(5)9-8/h2-4H,1H3/q+1.

What is the EC number of Azoic Diazo Component 34?

The EC number of Azoic Diazo Component 34 is 240-190-4.

What is the hydrogen bond donor count of Azoic Diazo Component 34?

The hydrogen bond donor count of Azoic Diazo Component 34 is 0.