Methyl 2-bromo-5-fluoroisonicotinate

• CAS: 885588-14-7
• Catalog Number: ACM885588147
• Category: Pyridines
• Molecular Weight: 234.0
• Molecular Formula: C7H5BrFNO2
• Synonyms: Methyl 2-Bromo-5-fluoropyridine-4-carboxylate

Custom Q&A

What is the molecular formula of methyl 2-bromo-5-fluoroisonicotinate?

The molecular formula is C7H5BrFNO2.

What is the molecular weight of methyl 2-bromo-5-fluoroisonicotinate?

The molecular weight is 234.02 g/mol.

What is the IUPAC name of methyl 2-bromo-5-fluoroisonicotinate?

The IUPAC name is methyl 2-bromo-5-fluoropyridine-4-carboxylate.

What is the InChI of methyl 2-bromo-5-fluoroisonicotinate?

The InChI is InChI=1S/C7H5BrFNO2/c1-12-7(11)4-2-6(8)10-3-5(4)9/h2-3H,1H3.

What is the InChIKey of methyl 2-bromo-5-fluoroisonicotinate?

The InChIKey is HLTNRIWFYBDWKA-UHFFFAOYSA-N.

What is the canonical SMILES of methyl 2-bromo-5-fluoroisonicotinate?

The canonical SMILES is COC(=O)C1=CC(=NC=C1F)Br.

What is the CAS number of methyl 2-bromo-5-fluoroisonicotinate?

The CAS number is 885588-14-7.

What is the European Community (EC) number of methyl 2-bromo-5-fluoroisonicotinate?

The European Community (EC) number is 807-206-7.

What is the Monoisotopic Mass of methyl 2-bromo-5-fluoroisonicotinate?

The Monoisotopic Mass is 232.94877 g/mol.

Is methyl 2-bromo-5-fluoroisonicotinate a canonicalized compound?

Yes, methyl 2-bromo-5-fluoroisonicotinate is canonicalized.