(3-Bromo-4-pyridyl)methanol

• CAS: 146679-66-5
• Catalog Number: ACM146679665-1
• Category: Pyridines
• Molecular Weight: 188.02
• Molecular Formula: C6H6BrNO
• Synonyms: 3-Bromo-4-(hydroxymethyl)pyridine
• Appearance: Solid

Custom Q&A

What is the molecular formula of (3-Bromo-4-pyridyl)methanol?

The molecular formula is C6H6BrNO.

What is the molecular weight of (3-Bromo-4-pyridyl)methanol?

The molecular weight is 188.02 g/mol.

What is the IUPAC name of (3-Bromo-4-pyridyl)methanol?

The IUPAC name is (3-bromopyridin-4-yl)methanol.

What is the InChI of (3-Bromo-4-pyridyl)methanol?

The InChI is InChI=1S/C6H6BrNO/c7-6-3-8-2-1-5(6)4-9/h1-3,9H,4H2.

What is the InChIKey of (3-Bromo-4-pyridyl)methanol?

The InChIKey is LQBUZBOVEZBDEB-UHFFFAOYSA-N.

What is the canonical SMILES of (3-Bromo-4-pyridyl)methanol?

The canonical SMILES is C1=CN=CC(=C1CO)Br.

What is the CAS number of (3-Bromo-4-pyridyl)methanol?

The CAS number is 146679-66-5.

What is the EC number of (3-Bromo-4-pyridyl)methanol?

The EC number is 694-910-0.

What is the XLogP3-AA value of (3-Bromo-4-pyridyl)methanol?

The XLogP3-AA value is 0.7.

Is (3-Bromo-4-pyridyl)methanol a canonicalized compound?

Yes, (3-Bromo-4-pyridyl)methanol is a canonicalized compound.