6-Bromo-2-chloro-3-fluoropyridine

• CAS: 1211591-93-3
• Catalog Number: ACM1211591933
• Category: Pyridines
• Molecular Weight: 210.43
• Molecular Formula: C5H2BrClFN

Custom Q&A

What is the molecular formula of 6-Bromo-2-chloro-3-fluoropyridine?

The molecular formula of 6-Bromo-2-chloro-3-fluoropyridine is C5H2BrClFN.

What is the molecular weight of 6-Bromo-2-chloro-3-fluoropyridine?

The molecular weight of 6-Bromo-2-chloro-3-fluoropyridine is 210.43 g/mol.

What is the IUPAC name of 6-Bromo-2-chloro-3-fluoropyridine?

The IUPAC name of 6-Bromo-2-chloro-3-fluoropyridine is 6-bromo-2-chloro-3-fluoropyridine.

What is the InChI of 6-Bromo-2-chloro-3-fluoropyridine?

The InChI of 6-Bromo-2-chloro-3-fluoropyridine is InChI=1S/C5H2BrClFN/c6-4-2-1-3(8)5(7)9-4/h1-2H.

What is the InChIKey of 6-Bromo-2-chloro-3-fluoropyridine?

The InChIKey of 6-Bromo-2-chloro-3-fluoropyridine is KPQMWTHSSFZPMJ-UHFFFAOYSA-N.

What is the canonical SMILES of 6-Bromo-2-chloro-3-fluoropyridine?

The canonical SMILES of 6-Bromo-2-chloro-3-fluoropyridine is C1=CC(=NC(=C1F)Cl)Br.

What is the CAS number of 6-Bromo-2-chloro-3-fluoropyridine?

The CAS number of 6-Bromo-2-chloro-3-fluoropyridine is 1211591-93-3.

How many hydrogen bond donor counts does 6-Bromo-2-chloro-3-fluoropyridine have?

6-Bromo-2-chloro-3-fluoropyridine has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 6-Bromo-2-chloro-3-fluoropyridine have?

6-Bromo-2-chloro-3-fluoropyridine has 2 hydrogen bond acceptor counts.