CAS
92-86-4 Purity
99%+
92-86-4 Purity
99%+
Inquiry Basket
5-Bromo-2-chloro-1,3-difluorobenzene
CAS
176673-72-6
Catalog Number
ACM176673726
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 5-Bromo-2-chloro-1,3-difluorobenzene?
The molecular formula of 5-Bromo-2-chloro-1,3-difluorobenzene is C6H2BrClF2.
What is the molecular weight of 5-Bromo-2-chloro-1,3-difluorobenzene?
The molecular weight of 5-Bromo-2-chloro-1,3-difluorobenzene is 227.43 g/mol.
What is the IUPAC name of 5-Bromo-2-chloro-1,3-difluorobenzene?
The IUPAC name of 5-Bromo-2-chloro-1,3-difluorobenzene is 5-bromo-2-chloro-1,3-difluorobenzene.
What is the InChI of 5-Bromo-2-chloro-1,3-difluorobenzene?
The InChI of 5-Bromo-2-chloro-1,3-difluorobenzene is InChI=1S/C6H2BrClF2/c7-3-1-4(9)6(8)5(10)2-3/h1-2H.
What is the InChIKey of 5-Bromo-2-chloro-1,3-difluorobenzene?
The InChIKey of 5-Bromo-2-chloro-1,3-difluorobenzene is SWELJVAWQMCJLG-UHFFFAOYSA-N.
What is the Canonical SMILES of 5-Bromo-2-chloro-1,3-difluorobenzene?
The Canonical SMILES of 5-Bromo-2-chloro-1,3-difluorobenzene is C1=C(C=C(C(=C1F)Cl)F)Br.
What is the CAS number of 5-Bromo-2-chloro-1,3-difluorobenzene?
The CAS number of 5-Bromo-2-chloro-1,3-difluorobenzene is 176673-72-6.
What is the XLogP3-AA value of 5-Bromo-2-chloro-1,3-difluorobenzene?
The XLogP3-AA value of 5-Bromo-2-chloro-1,3-difluorobenzene is 3.4.
What is the hydrogen bond donor count of 5-Bromo-2-chloro-1,3-difluorobenzene?
The hydrogen bond donor count of 5-Bromo-2-chloro-1,3-difluorobenzene is 0.
What is the topological polar surface area of 5-Bromo-2-chloro-1,3-difluorobenzene?
The topological polar surface area of 5-Bromo-2-chloro-1,3-difluorobenzene is 0Ų.
Recommended Products
