CAS
176673-72-6 Purity
---
176673-72-6 Purity
---
Inquiry Basket
1-Bromo-2,3,6-trifluorobenzene
CAS
176793-04-7
Catalog Number
ACM176793047
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 1-Bromo-2,3,6-trifluorobenzene?
The molecular formula of 1-Bromo-2,3,6-trifluorobenzene is C6H2BrF3.
What is the molecular weight of 1-Bromo-2,3,6-trifluorobenzene?
The molecular weight of 1-Bromo-2,3,6-trifluorobenzene is 210.98 g/mol.
What is the IUPAC name of 1-Bromo-2,3,6-trifluorobenzene?
The IUPAC name of 1-Bromo-2,3,6-trifluorobenzene is 2-bromo-1,3,4-trifluorobenzene.
What is the InChI of 1-Bromo-2,3,6-trifluorobenzene?
The InChI of 1-Bromo-2,3,6-trifluorobenzene is InChI=1S/C6H2BrF3/c7-5-3(8)1-2-4(9)6(5)10/h1-2H.
What is the InChIKey of 1-Bromo-2,3,6-trifluorobenzene?
The InChIKey of 1-Bromo-2,3,6-trifluorobenzene is CNAXDCSHYHIOGW-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Bromo-2,3,6-trifluorobenzene?
The canonical SMILES of 1-Bromo-2,3,6-trifluorobenzene is C1=CC(=C(C(=C1F)F)Br)F.
What is the CAS number of 1-Bromo-2,3,6-trifluorobenzene?
The CAS number of 1-Bromo-2,3,6-trifluorobenzene is 176793-04-7.
What is the XLogP3-AA value of 1-Bromo-2,3,6-trifluorobenzene?
The XLogP3-AA value of 1-Bromo-2,3,6-trifluorobenzene is 2.9.
How many hydrogen bond donor counts does 1-Bromo-2,3,6-trifluorobenzene have?
1-Bromo-2,3,6-trifluorobenzene has 0 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 1-Bromo-2,3,6-trifluorobenzene have?
1-Bromo-2,3,6-trifluorobenzene has 3 hydrogen bond acceptor counts.
Recommended Products
