CAS
176548-70-2 Purity
98%+
176548-70-2 Purity
98%+
Inquiry Basket
5-Benzyloxy-2-bromotoluene
CAS
17671-75-9
Catalog Number
ACM17671759
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 5-Benzyloxy-2-bromotoluene?
The molecular formula of 5-Benzyloxy-2-bromotoluene is C14H13BrO.
What is the molecular weight of 5-Benzyloxy-2-bromotoluene?
The molecular weight of 5-Benzyloxy-2-bromotoluene is 277.16 g/mol.
What is the IUPAC name of 5-Benzyloxy-2-bromotoluene?
The IUPAC name of 5-Benzyloxy-2-bromotoluene is 1-bromo-2-methyl-4-phenylmethoxybenzene.
What is the InChI of 5-Benzyloxy-2-bromotoluene?
The InChI of 5-Benzyloxy-2-bromotoluene is InChI=1S/C14H13BrO/c1-11-9-13(7-8-14(11)15)16-10-12-5-3-2-4-6-12/h2-9H,10H2,1H3.
What is the InChIKey of 5-Benzyloxy-2-bromotoluene?
The InChIKey of 5-Benzyloxy-2-bromotoluene is KOLLVAZFQFRSHI-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Benzyloxy-2-bromotoluene?
The canonical SMILES of 5-Benzyloxy-2-bromotoluene is CC1=C(C=CC(=C1)OCC2=CC=CC=C2)Br.
What is the CAS number of 5-Benzyloxy-2-bromotoluene?
The CAS number of 5-Benzyloxy-2-bromotoluene is 17671-75-9.
What is the XLogP3-AA value of 5-Benzyloxy-2-bromotoluene?
The XLogP3-AA value of 5-Benzyloxy-2-bromotoluene is 4.4.
How many hydrogen bond donor counts does 5-Benzyloxy-2-bromotoluene have?
5-Benzyloxy-2-bromotoluene has 0 hydrogen bond donor count.
How many rotatable bond counts does 5-Benzyloxy-2-bromotoluene have?
5-Benzyloxy-2-bromotoluene has 3 rotatable bond counts.
Recommended Products
