5-Amino-2-fluorophenylboronic acid

• CAS: 873566-74-6
• Catalog Number: ACM873566746
• Category: Other Products; Boronic Acids
• Molecular Formula: C₆H₇BFNO₂

Custom Reviews

May 23, 2023

---

A useful catalyst for drug synthesis.
5-Amino-2-fluorophenylboronic acid can catalyze the synthesis of pyrimidine formamide compound pharmaceutical preparations.

Custom Q&A

What is the molecular formula of 5-Amino-2-fluorophenylboronic acid?

The molecular formula of 5-Amino-2-fluorophenylboronic acid is C6H7BFNO2.

What is the molecular weight of 5-Amino-2-fluorophenylboronic acid?

The molecular weight of 5-Amino-2-fluorophenylboronic acid is 154.94 g/mol.

When was 5-Amino-2-fluorophenylboronic acid created?

5-Amino-2-fluorophenylboronic acid was created on September 16, 2005.

What is the IUPAC name of 5-Amino-2-fluorophenylboronic acid?

The IUPAC name of 5-Amino-2-fluorophenylboronic acid is (5-amino-2-fluorophenyl)boronic acid.

What is the InChI of 5-Amino-2-fluorophenylboronic acid?

The InChI of 5-Amino-2-fluorophenylboronic acid is InChI=1S/C6H7BFNO2/c8-6-2-1-4(9)3-5(6)7(10)11/h1-3,10-11H,9H2.

What is the InChIKey of 5-Amino-2-fluorophenylboronic acid?

The InChIKey of 5-Amino-2-fluorophenylboronic acid is CDZMVORRMKESPD-UHFFFAOYSA-N.

What is the canonical SMILES of 5-Amino-2-fluorophenylboronic acid?

The canonical SMILES of 5-Amino-2-fluorophenylboronic acid is B(C1=C(C=CC(=C1)N)F)(O)O.

What is the CAS number of 5-Amino-2-fluorophenylboronic acid?

The CAS number of 5-Amino-2-fluorophenylboronic acid is 873566-74-6.

What is the hydrogen bond donor count of 5-Amino-2-fluorophenylboronic acid?

The hydrogen bond donor count of 5-Amino-2-fluorophenylboronic acid is 3.

Is 5-Amino-2-fluorophenylboronic acid a canonicalized compound?

Yes, 5-Amino-2-fluorophenylboronic acid is a canonicalized compound.